| Identification | |
| Name: | 4,5-Imidazoledicarboxylic acid |
| Synonyms: | 1H-Imidazole-4, 5-dicarboxylic acid;4,5-Imidazoledicarboxylate;5-25-05-00344 (Beilstein Handbook Reference);4,5-Dicarboxyimidazole;Glyoxalinedicarboxylic acid;Glycoxalinedicarboxylic acid;1H-imidazole-4,5-dicarboxylate;alpha-beta-Imidazolecarboxylic acid; |
| CAS: | 570-22-9 |
| EINECS: | 209-327-5 |
| Molecular Formula: | C5H4N2O4 |
| Molecular Weight: | 156.09626 |
| InChI: | InChI=1S/C5H4N2O4/c8-4(9)2-3(5(10)11)7-1-6-2/h1H,(H,6,7)(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 335.5 ºC |
| Boiling Point: | 631.1ºC at 760 mmHg |
| Density: | 1.749 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble in ammonia or alkali solution, insoluble in water, ethanol, ethyl ether |
| Solubility: | soluble in ammonia or alkali solution, insoluble in water, ethanol, ethyl ether |
| Appearance: | light yellow to yellow-brown fine cryst. powder |
| Specification: |
Imidazole-4,5-dicarboxylic acid (570-22-9) is also named as 4,5-Dicarboxyimidazole ; 4,5-Imidazoledicarboxylate ; 5-25-05-00344 (Beilstein Handbook Reference) ; AI3-52411 ; BRN 0147774 ; Glycoxalinedicarboxylic acid ; Glyoxalinedicarboxylic acid ; NSC 9236 ; alpha,beta-Imidazoledicarboxylic acid ; alpha-beta-Imidazolecarboxylic acid (570-22-9) is light yellow to yellow-brown fine cryst. powder. It is soluble in ammonia or alkali solution, insoluble in water, ethanol, ethyl ether. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29332990 |
| Flash Point: | 335.5 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
