| Identification | ||
| Name: | 2-Methyl-6-nitroaniline | |
| Synonyms: | 2-Amino-3-nitrotoluene~6-Nitro-o-toluidine; 6-Nitro-o-toluidine; Methylnitroaniline, 99%; 6-Nitro-2-Methylaniline; 2-Methyl-6-nitroaniline,(2-Amino-3-nitrotoluene; 6-Nitro-o-tol; 2-Amino-3-nitrotoluene; 2-Amino-3-methylnitrobenzene | |
| CAS: | 570-24-1 | |
| EINECS: | 209-329-6 | |
| Molecular Formula: | C7H8N2O2 | |
| Molecular Weight: | 152.15 | |
| InChI: | InChI=1/C7H8N2O2/c1-5-3-2-4-6(7(5)8)9(10)11/h2-4H,8H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2660 | |
| Density: | 1.269 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.558 | |
| Water Solubility: | <0.1 g/100 mL at 23 ºC | |
| Solubility: | Insoluble | |
| Appearance: | redish-brown solid | |
| Specification: |
2-Methyl-6-nitroaniline (CAS NO.570-24-1) is also named as 1-Amino-2-methyl-6-nitrobenzene ; 2-Methyl-6-nitro-benzenamine ; 6-Nitro-o-toluidine ; Benzenamine, 2-methyl-6-nitro- ; NSC 286 . 2-Methyl-6-nitroaniline (CAS NO.570-24-1) is redish-brown solid. It is insoluble in water. 2-Methyl-6-nitroaniline is sensitive to prolonged exposure to air. It is incompatible with acids, acid chlorides, acid anhydrides, chloroformates, and strong oxidizers.Flash point data for 2-Methyl-6-nitroaniline are not available, but it is probably combustible. | |
| Packinggroup: | III | |
| HS Code: | 29214300 | |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
 |
||
