| Identification | |
| Name: | Ethanone,1-(4-azidophenyl)-2-bromo- |
| Synonyms: | 1-(4-Azidophenyl)-2-bromoethanone;2-Bromo-4'-azidoacetophenone; 4-Azidophenacyl bromide;4'-Azido-2-bromoacetophenone; p-Azidophenacetyl bromide; p-Azidophenacylbromide |
| CAS: | 57018-46-9 |
| EINECS: | 260-519-5 |
| Molecular Formula: | C8H6 Br N3 O |
| Molecular Weight: | 240.06 |
| InChI: | InChI=1/C8H6BrN3O/c9-5-8(13)6-1-3-7(4-2-6)11-12-10/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Melting Point: | 64-65 °C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | Off-white crystalline solid |
| Specification: | Off-White Crystalline Solid usageEng:A versatile photolabile bifunctional reagent. Useful for investigating the active sites of sulfhydryl enzymes-particularly those which posess a particularly reactive cysteine residue at the active site. Used to study the nature of the ribosomal binding site of E. coli tRNAVal. Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Usage: | A versatile photolabile bifunctional reagent. Useful for investigating the active sites of sulfhydryl enzymes-particularly those which posess a particularly reactive cysteine residue at the active site. Used to study the nature of the ribosomal bindin |
| Safety Data | |
 |
|
