| Identification | |
| Name: | 1H-Purine-2,6-dione,1,3-dibutyl-3,7-dihydro-7-(2-oxopropyl)- |
| Synonyms: | BRL 30892;Denbufylline |
| CAS: | 57076-71-8 |
| Molecular Formula: | C16H24 N4 O3 |
| Molecular Weight: | 320.39 |
| InChI: | InChI=1/C16H24N4O3/c1-4-6-8-19-14-13(18(11-17-14)10-12(3)21)15(22)20(16(19)23)9-7-5-2/h11H,4-10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 265.1°C |
| Boiling Point: | 514.8°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.594 |
| Specification: | White Solid usageEng:A cell permeable xanthine derivatvie that acts as a selective inhibitor of phosphodiesterase IV (PDE IV). Possesses bronchodilatory properties. Displays negative inotropic effect by acting on a verapamil-sensitive site of the calcium channel in guinea pig ventricle apaillary muscle independently of its PDE inhibitory activity. |
| Flash Point: | 265.1°C |
| Storage Temperature: | Refrigerator |
| Usage: | A cell permeable xanthine derivatvie that acts as a selective inhibitor of phosphodiesterase IV (PDE IV). Possesses bronchodilatory properties. Displays negative inotropic effect by acting on a verapamil-sensitive site of the calcium channel in gu |
| Safety Data | |
 |
|
