| Identification | |
| Name: | 1H-Benzimidazole,1-methyl-2-nitro- |
| Synonyms: | Benzimidazole,1-methyl-2-nitro- (7CI,8CI); 1-Methyl-2-nitrobenzimidazole |
| CAS: | 5709-68-2 |
| Molecular Formula: | C8H7 N3 O2 |
| Molecular Weight: | 177.18 |
| InChI: | InChI=1/C8H7N3O2/c1-10-7-5-3-2-4-6(7)9-8(10)11(12)13/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.8°C |
| Boiling Point: | 378.6°C at 760 mmHg |
| Density: | 1.42g/cm3 |
| Refractive index: | 1.676 |
| Specification: |
1-Methyl-2-nitrobenzimidazole with cas registry number of 5709-68-2 is also known as Benzimidazole,1-methyl-2-nitro- ; 1H-benzimidazole, 1-methyl-2-nitro- ; 1-Methyl-2-nitro-1H-benzoimidazole ; 1-Methyl-2-nitrobenzimidazole ; 1-N-Methyl-2-nitrobenzimidazole . It should be stored in a cool, dry place . 1-Methyl-2-nitrobenzimidazole with cas registry number of 5709-68-2 is used as a drug . It is also used as a pharmaceutical intermediate in synthesis of many useful compounds. |
| Flash Point: | 182.8°C |
| Safety Data | |
 |
|
