| Identification | |
| Name: | Acetic acid,trimethylplumbyl ester |
| Synonyms: | Lead,acetoxytrimethyl- (7CI); Plumbane, (acetyloxy)trimethyl- (9CI); Plumbane,acetoxytrimethyl- (8CI); Trimethyllead acetate (6CI); Acetoxytrimethylplumbane;NSC 102500 |
| CAS: | 5711-19-3 |
| EINECS: | 227-200-2 |
| Molecular Formula: | C5H12 O2 Pb |
| Molecular Weight: | 311.36 |
| InChI: | InChI=1/C2H4O2.3CH3.Pb/c1-2(3)4;;;;/h1H3,(H,3,4);3*1H3;/rC3H9Pb.C2H4O2/c1-4(2)3;1-2(3)4/h1-3H3;1H3,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Melting Point: | 180 °C (dec.)(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Safety Statements:53-45-60-61 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | °C |
| Safety Data | |
 |
|
