Identification |
Name: | Phosphorodithioicacid, O,O-diethyl S-[2-[[[(4-methylphenyl)amino]carbonyl]amino]-2-oxoethyl]ester |
Synonyms: | Phosphorodithioicacid, O,O-diethyl ester, S-ester with 1-(mercaptoacetyl)-3-p-tolylurea(7CI,8CI); Urea, 1-(mercaptoacetyl)-3-p-tolyl-, S-ester with O,O-diethylphosphorodithioate |
CAS: | 5711-50-2 |
Molecular Formula: | C14H21 N2 O4 P S2 |
Molecular Weight: | 342.3459 |
InChI: | InChI=1/C18H18N2O5/c1-23-11-8-14(24-2)17(15(9-11)25-3)18(22)20-10-16(21)19-12-6-4-5-7-13(12)20/h4-9H,10H2,1-3H3,(H,19,21) |
Molecular Structure: |
|
Properties |
Flash Point: | 320°C |
Boiling Point: | 605.6°Cat760mmHg |
Density: | 1.273g/cm3 |
Refractive index: | 1.588 |
Flash Point: | 320°C |
Safety Data |
|
|