| Identification | |
| Name: | 2,3,4,7,8-Pentachlorodibenzofuran |
| Synonyms: | 2,3,4,7,8-pentachloro-dibenzofura;Dibenzofuran, 2,3,4,7,8-pentachloro-;2,3,4,7,8-PECDF;2,3,4,7,8-PENTACHLORODIPHENYLENEOXIDE;2,3,4,7,8-PNCDF;2,3,4,7,8-PENTACDF;2,3,4,7,8-PCDF;23478PENTACHLORODIBENZO-PARA-FURAN |
| CAS: | 57117-31-4 |
| Molecular Formula: | C12H3Cl5O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H3Cl5O/c13-6-1-4-5-2-8(15)10(16)11(17)12(5)18-9(4)3-7(6)14/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 196-196.5 deg C |
| Flash Point: | 226.3°C |
| Boiling Point: | 450.6°C at 760 mmHg |
| Density: | 1.7g/cm3 |
| Refractive index: | 1.715 |
| Solubility: | In water, 0.000235 mg/liter @ 23 deg C |
| Specification: |
2,3,4,7,8-Pentachlorodibenzofuran (CAS NO.57117-31-4) base on increased incidences of hepatocellular adenoma and cholangiocarcinoma of the liver and gingival squamous cell carcinoma of the oral mucosa. Occurrences of cystic keratinizing epithelioma of the lung, neoplasms of the pancreatic acinus, and carcinoma of the uterus may have been related to administration of PeCDF. |
| Packinggroup: | I |
| Flash Point: | 226.3°C |
| Safety Data | |
 |
|
