| Identification |
| Name: | N-(hydroxymethyl)-2-methyl-prop-2-enamide; 2-methylidenebutanoic acid; methyl 2-methylprop-2-enoate; prop-2-enoic acid |
| Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethyl 2-propenoate, N-(hydroxymethyl)-2-methyl-2-propenamide and 2-propenoic acid;2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethyl 2-propenoate, N-(hydroxymethyl)-2-methyl-2-propenamide and 2-propenoic acid 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethyl 2-propenoate,N-(hydroxymethyl)-2-methyl-2-propenamide and 2-propenoic acid |
| CAS: | 57216-22-5 |
| Molecular Formula: | C18H29NO8 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H9NO2.2C5H8O2.C3H4O2/c1-4(2)5(8)6-3-7;1-4(2)5(6)7-3;1-3-4(2)5(6)7;1-2-3(4)5/h7H,1,3H2,2H3,(H,6,8);1H2,2-3H3;2-3H2,1H3,(H,6,7);2H,1H2,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 139°C |
| Boiling Point: | 306.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 139°C |
| Safety Data |
| |
 |
