| Identification | |
| Name: | 2,2-Dimethylcyclopropyl cyanide |
| Synonyms: | 2,2-dimethylcyclopropane-1-carbonitrile; |
| CAS: | 5722-11-2 |
| Molecular Formula: | C6H9N |
| Molecular Weight: | 95.14 |
| InChI: | InChI=1S/C6H9N/c1-6(2)3-5(6)4-7/h5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.91 g/cm3 |
| Specification: |
The 2,2-Dimethylcyclopropyl cyanide, with the CAS registry number 5722-11-2, is also known as 1-Cyano-2,2-dimethylcyclopropane. This chemical's molecular formula is C6H9N and formula weight is 95.14. What's more, its IUPAC name and systematic name are the same which is called 2,2-dimethylcyclopropane-1-carbonitrile. Physical properties of 2,2-Dimethylcyclopropyl cyanide: (1)ACD/LogP: 0.95; (2)#H bond acceptors: 1; (3)#H bond donors: 0; (4)#Freely Rotating Bonds: 0; (5)Polar Surface Area: 23.79 Å2; (6)Index of Refraction: 1.447; (7)Molar Refractivity: 27.7 cm3; (8)Molar Volume: 103.6 cm3; (9)Surface Tension: 30.8 dyne/cm; (10)Density: 0.91 g/cm3; (11)Flash Point: 35.7 °C; (12)Enthalpy of Vaporization: 37.82 kJ/mol; (13)Boiling Point: 140.9 °C at 760 mmHg; (14)Vapour Pressure: 5.99 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
