| Identification | |
| Name: | 3-Thiophenecarbonylchloride, 2,5-dichloro- |
| Synonyms: | 2,5-Dichloro-3-thenoylchloride; 2,5-Dichlorothiophene-3-carbonyl chloride |
| CAS: | 57248-14-3 |
| Molecular Formula: | C5H Cl3 O S |
| Molecular Weight: | 215.48 |
| InChI: | InChI=1/C5HCl3OS/c6-3-1-2(4(7)9)5(8)10-3/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 244.3°Cat760mmHg |
| Boiling Point: | 244.3°Cat760mmHg |
| Density: | 1.667g/cm3 |
| Refractive index: | 1.607 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 244.3°Cat760mmHg |
| Safety Data | |
 |
|
