| Identification | |
| Name: | L-lysine acetate |
| Synonyms: | L-lysine Hac; L-Lysine acetate salt; (S)-2,6-Diaminohexanoic acid acetate salt; L-Lysine monoacetate |
| CAS: | 57282-49-2 |
| EINECS: | 260-664-4 |
| Molecular Formula: | C6H14N2O2?C2H4O2 |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C6H14N2O2.C2H4O2/c7-4-2-1-3-5(8)6(9)10;1-2(3)4/h5H,1-4,7-8H2,(H,9,10);1H3,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 224 deg C, decomposes |
| Solubility: | Insoluble in ethanol, ethyl ether, acetone, benzene Insolulble in common neutral solvents Very freely soluble in water. Water solubility: >100 g/100 g H20 at 25 deg C In water, 5.84X10+5 mg/L at 27 deg C |
| Specification: |
L-Lysine monoacetate , with CAS number of 57282-49-2, can be called acetic acid; (2S)-2,6-diaminohexanoic acid ; L-Lysine monoacetate ; acetic acid; 2,6-diaminohexanoic acid ; Lysine acetate (USP) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Needles from water, hexagonal plates from dilute alcohol Colorless crystals |
| Safety Data | |
 |
|
