Identification |
Name: | Uridine, 4-hydrazone(9CI) |
Synonyms: | Cytidine,N-amino-; N4-Aminocytidine |
CAS: | 57294-74-3 |
Molecular Formula: | C9H14 N4 O5 |
Molecular Weight: | 258.27 |
InChI: | InChI=1/C9H14N4O5/c10-12-5-1-2-13(9(17)11-5)8-7(16)6(15)4(3-14)18-8/h1-2,4,6-8,14-16H,3,10H2,(H,11,12,17) |
Molecular Structure: |
|
Properties |
Flash Point: | 289.8°C |
Boiling Point: | 555.5°Cat760mmHg |
Density: | 1.93g/cm3 |
Refractive index: | 1.776 |
Specification: |
N(4)-Aminocytidine (CAS NO.57294-74-3) is also named as CCRIS 2527 ; N(sup 4)-Aminocytidine ; N4-Aminocytidine Uridine, 4-hydrazone . N(4)-Aminocytidine (CAS NO.57294-74-3) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry.
|
Flash Point: | 289.8°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|