| Identification | |
| Name: | Cyclopropanecarboximidamide,hydrochloride (1:1) |
| Synonyms: | Cyclopropanecarboximidamide,monohydrochloride (9CI);Cyclopropanecarboxamidine hydrochloride;Cyclopropylcarbamidinehydrochloride;Cyclopropylformamidine hydrochloride; |
| CAS: | 57297-29-7 |
| EINECS: | -0 |
| Molecular Formula: | C4H8N2.HCl |
| Molecular Weight: | 120.58 |
| InChI: | InChI=1/C4H8N2/c5-4(6)3-1-2-3/h3H,1-2H2,(H3,5,6)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.37g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
