| Identification | |
| Name: | 1,4-Epoxynaphthalene,1,4-dihydro- |
| Synonyms: | 1,4-Dihydro-1,4-epoxynaphthalene;1,4-Dihydronaphthalene-1,4-endo-oxide;1,4-Dihydronaphthalene-1,4-epoxide;1,4-Dihydronaphthalene-1,4-oxide;1,4-Epoxy-1,4-dihydronaphthalene;7-Oxabenzonorbornadiene;Benzooxanorbornadiene;NSC 101863; |
| CAS: | 573-57-9 |
| Molecular Formula: | C10H8O |
| Molecular Weight: | 144.16992 |
| InChI: | InChI=1S/C10H8O/c1-2-4-8-7(3-1)9-5-6-10(8)11-9/h1-6,9-10H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 54-56 ºC |
| Flash Point: | 93 ºC |
| Density: | 1.207 g/cm3 |
| Refractive index: | 1.626 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | White, adhering crystals crystals. |
| Specification: | white to yellow crystalline solid Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 93 ºC |
| Safety Data | |
 |
|
