| Identification | |
| Name: | Potassium 2,4,6-trinitrophenolate |
| Synonyms: | POTASSIUM 2,4,6-TRINITROPHENOLATE;POTASSIUM PICRATE;2,4,6-trinitro-phenopotassiumsalt;POTASSIUM PICRATE ANHYDROUS;Picric acid potassium |
| CAS: | 573-83-1 |
| EINECS: | 209-361-0 |
| Molecular Formula: | C6H2KNO7 |
| Molecular Weight: | 267.19 |
| InChI: | InChI=1/C6H3N3O7.K/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 122-123 deg C |
| Flash Point: | 133.9°C |
| Boiling Point: | 303.6°C at 760 mmHg |
| Density: | g/cm3 |
| Solubility: | 1 g in 78 ml water @ 25 deg C, 15 ml boiling water, 12 ml alcohol, 10 ml benzene, 35 ml chloroform, and 65 ml ether Soluble in ethanol and ether, very soluble in acetone In water, 1.27X10+4 mg/l @ 25 deg C |
| Flash Point: | 133.9°C |
| Color: | Yellow crystals Yellow ... solid [Note: Usually used as an aqeous solution]. |
| Safety Data | |
 |
|
