| Identification | |
| Name: | [1,1'-Biphenyl]-4-carboxylicacid, 4'-bromo- |
| Synonyms: | 4-Biphenylcarboxylicacid, 4'-bromo- (6CI,7CI,8CI); 4-(4-Bromophenyl)benzoic acid;4'-Bromo-4-biphenylcarboxylic acid |
| CAS: | 5731-11-3 |
| Molecular Formula: | C13H9 Br O2 |
| Molecular Weight: | 277.11 |
| InChI: | InChI=1/C13H9BrO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 301-302°C |
| Flash Point: | 206.7°C |
| Boiling Point: | 418.1°C at 760 mmHg |
| Density: | 1.51g/cm3 |
| Refractive index: | 1.632 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 206.7°C |
| Safety Data | |
 |
|
