| Identification | |
| Name: | 1,3-Dioxolane-4-carboxaldehyde,2,2-dimethyl- |
| Synonyms: | 2,2-Dimethyl-1,3-dioxolane-4-carboxaldehyde;2,3-O-Isopropylideneglyceraldehyde; Acetone, cyclic formylethylene acetal;Glyceraldehyde, cyclic acetal with acetone; Racemic-solketyl aldehyde |
| CAS: | 5736-03-8 |
| EINECS: | 227-244-2 |
| Molecular Formula: | C6H10 O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-6(2)8-4-5(3-7)9-6/h3,5H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.123 g/cm3 |
| Refractive index: | 1.481 |
| Specification: |
1,3-Dioxolane-4-carboxaldehyde,2,2-dimethyl- (CAS NO.5736-03-8) is also called as EINECS 227-244-2 ; Glyceraldehyde, cyclic acetal with acetone ; 2,2-Dimethyl-1,3-dioxolane-4-carbaldehyde ; 2,2-Dimethyl-1,3-dioxolane-4-carboxaldehyde ; 2,3-O-isopropylideneglyceraldehyde ; Acetone, cyclic formylethylene acetal ; Racemic-solketyl aldehyde ; 4-Formyl-2,2-dimethyloxolane . |
| Safety Data | |
 |
|
