| Identification |
| Name: | Ethanone,2-(acetyloxy)-1,2-diphenyl- |
| CAS: | 574-06-1 |
| Molecular Formula: | C16H14 O3 |
| Molecular Weight: | 254.28056 |
| InChI: | InChI=1S/C16H14O3/c1-12(17)19-16(14-10-6-3-7-11-14)15(18)13-8-4-2-5-9-13/h2-11,16H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 81-82 °C(lit.)
|
| Flash Point: | 167.2°C |
| Boiling Point: | 379.3°Cat760mmHg |
| Density: | 1.161g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive EC/548/EEC. Toxicity data (The meaning of any toxic |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 167.2°C |
| Safety Data |
| |
 |
