Identification |
Name: | Ethanone,2-ethoxy-1,2-diphenyl- |
Synonyms: | Acetophenone,2-ethoxy-2-phenyl- (7CI,8CI);2-Ethoxy-2-phenylacetophenone;2-Ethoxybenzoin;Benzoin ethyl ether;Ethoxybenzoin;Ethyl benzoin ether;PS 8A;Seikuol BEE;dl-Benzoin ethyl ether; |
CAS: | 574-09-4 |
EINECS: | 210-849-0 |
Molecular Formula: | C16H16O2 |
Molecular Weight: | 240.29704 |
InChI: | InChI=1S/C16H16O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 50kgs |
Flash Point: | 152.3°C |
Density: | 1.1016 |
Refractive index: | 1.5727 |
Water Solubility: | AUTOIGNITION |
Solubility: | AUTOIGNITION Appearance:white to off-white powder Transport Information:50kgs Hazard Symbols:UN NO. MSDS:View
|
Appearance: | white to off-white powder |
Flash Point: | 152.3°C |
Safety Data |
Hazard Symbols |
|
|
 |