| Identification | |
| Name: | 1H-Pyrazole-3-carboxylicacid, 1,5-dimethyl-, ethyl ester |
| Synonyms: | Pyrazole-3-carboxylicacid, 1,5-dimethyl-, ethyl ester (7CI,8CI);Ethyl1,5-dimethyl-1H-pyrazole-3-carboxylate;Ethyl1,5-dimethylpyrazole-3-carboxylate; |
| CAS: | 5744-51-4 |
| Molecular Formula: | C8H12N2O2 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C8H12N2O2/c1-4-12-8(11)7-5-6(2)10(3)9-7/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.521 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
