| Identification | |
| Name: | 1H-Pyrazole-3-carboxylicacid, 1,5-dimethyl- |
| Synonyms: | Pyrazole-3-carboxylicacid, 1,5-dimethyl- (6CI,7CI,8CI); 1,5-Dimethyl-1H-pyrazole-3-carboxylic acid;1,5-Dimethyl-1H-pyrazole-3-carboxylic acid; 1,5-Dimethyl-3-pyrazolecarboxylicacid |
| CAS: | 5744-59-2 |
| Molecular Formula: | C6H8 N2 O2 |
| Molecular Weight: | 140.1399 |
| InChI: | InChI=1/C6H8N2O2/c1-4-3-5(6(9)10)7-8(4)2/h3H,1-2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 170oC |
| Flash Point: | 136.7 oC |
| Boiling Point: | 302.4 oC at 760 mmHg |
| Density: | 1.28 g/cm3 |
| Refractive index: | 1.575 |
| Specification: |
1,5-Dimethylpyrazole-3-carboxylic acid , its cas register number is 5744-59-2. It also can be called 1H-pyrazole-3-carboxylic acid, 1,5-dimethyl- ; Pyrazole-3-carboxylic acid, 1,5-dimethyl- . 1,5-Dimethylpyrazole-3-carboxylic acid (CAS NO.5744-59-2) is irritating to eyes, respiratory system and skin. So you should wear suitable protective clothing, gloves and eye/face protection. |
| Flash Point: | 136.7 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
