| Identification | |
| Name: | L-Lysine,N6-(carboxymethyl)- |
| Synonyms: | Lysine,N6-(carboxymethyl)-, L- (8CI); N6-(Carboxymethyl)lysine; Ne-(Carboxymethyl)lysine; e-(Carboxymethyl)lysine |
| CAS: | 5746-04-3 |
| Molecular Formula: | C8H16 N2 O4 |
| Molecular Weight: | 204.22 |
| InChI: | InChI=1/C14H10Cl2FNOS/c15-10-3-1-2-4-13(10)20-8-14(19)18-9-5-6-12(17)11(16)7-9/h1-7H,8H2,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 213.2°C |
| Boiling Point: | 428.9°Cat760mmHg |
| Density: | 1.255g/cm3 |
| Refractive index: | 1.639 |
| Appearance: | Off-white solid |
| Specification: | Off-White Solid usageEng:CEL and CML are two stable, nonenzymatic chemical modifications of protein lysine residues resulting from glycation and oxidation reactions. |
| Flash Point: | 213.2°C |
| Usage: | CEL and CML are two stable, nonenzymatic chemical modifications of protein lysine residues resulting from glycation and oxidation reactions. |
| Safety Data | |
 |
|
