| Identification | |
| Name: | 3-Isopropylphenyl N-isobutyryl-N-methylcarbamate |
| Synonyms: | N-Methyl-N-(1-oxo-2-methylpropyl)carbamic acid 3-(1-methylethyl)phenyl ester;OMS-978 |
| CAS: | 5748-26-5 |
| Molecular Formula: | C15H23NO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H21NO3/c1-10(2)12-7-6-8-13(9-12)19-15(18)16(5)14(17)11(3)4/h6-11H,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.8°C |
| Boiling Point: | 338.9°C at 760 mmHg |
| Density: | 1.062g/cm3 |
| Refractive index: | 1.508 |
| Specification: |
3-Isopropylphenyl N-isobutyryl-N-methylcarbamate , its cas register number is 5748-26-5. It also can be called OMS-978 ; Carbamic acid, methyl(2-methyl-1-oxopropyl)-, 3-(1-methylethyl)phenyl ester (9CI) ; and Carbamic acid, isobutyrylmethyl-, m-cumenyl ester . |
| Flash Point: | 158.8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
