| Identification |
| Name: | chloroethene; propane-1,2-diol; prop-2-enoic acid |
| Synonyms: | 2-Propenoic acid, monoester with 1,2-propanediol, polymer with chloroethene;2-propenoic acid, monoester with 1,2-propanediol,polymer with chloroethene;2-Propenoic acid,monoester with 1,2-propanediol,polymer with chloroethene |
| CAS: | 57495-45-1 |
| Molecular Formula: | C8H15ClO4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C3H8O2.C3H4O2.C2H3Cl/c1-3(5)2-4;1-2-3(4)5;1-2-3/h3-5H,2H2,1H3;2H,1H2,(H,4,5);2H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 107.2°C |
| Boiling Point: | 184.8°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 107.2°C |
| Safety Data |
| |
 |
