| Identification | |
| Name: | 1,7-Dihydroxynaphthalene |
| Synonyms: | 1,7-Naphthalenediol; 1,7-Napthalenediol; 1,7-dihydroxyl Naphthalene |
| CAS: | 575-38-2 |
| EINECS: | 209-383-0 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.16932 |
| InChI: | InChI=1S/C10H8O2/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h1-6,11-12H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.33 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.725 |
| Water Solubility: | slightly soluble AUTOIGNITION |
| Solubility: | slightly soluble AUTOIGNITION |
| Appearance: | gray to brown powder |
| Specification: | Yellowish to white powder Safety Statements:26-36-37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37:Wear suitable protective clothing and gloves |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Oxidizing coloring agents for hair dyeing. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
