| Identification | |
| Name: | Propanoic acid,3-amino-3-imino-, ethyl ester, hydrochloride (1:1) |
| Synonyms: | Aceticacid, amidino-, ethyl ester, hydrochloride (7CI);Propanoic acid, 3-amino-3-imino-,ethyl ester, monohydrochloride (9CI);(Ethoxycarbonyl)acetamidinemonohydrochloride;Carbamimidoylacetic acid ethyl ester hydrochloride;Ethyl3-amino-3-iminopropanoate hydrochloride;Ethyl amidinoacetate hydrochloride; |
| CAS: | 57508-48-2 |
| Molecular Formula: | C5H10N2O2.HCl |
| Molecular Weight: | 166.61 |
| InChI: | InChI=1/C5H10N2O2/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H3,6,7)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 3-Amino-3-iminopropanoic acid ethyl ester hydrochloride, its cas register number is 57508-48-2. It also can be called as Propanoic acid,3-amino-3-imino-, ethyl ester, hydrochloride (1:1) and the IUPAC name about this chemical is ethyl 3-Amino-3-iminopropanoate hydrochloride. It belongs to the following product categories, such as Acids and Derivatives, Boron, Nitrile, Thio,& TM-Cpds, pharmacetical and so on. Physical properties about 3-Amino-3-iminopropanoic acid ethyl ester hydrochloride are: (1)#H bond acceptors: 4; (2)#H bond donors: 3; (3)#Freely Rotating Bonds: 4; (4)Polar Surface Area: 76.17Å2; (5)Enthalpy of Vaporization: 48.44 kJ/mol; (6)Vapour Pressure: 0.0352 mmHg at 25°C You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
