| Identification | |
| Name: | Piperazine,1-(1-naphthalenyl)- |
| Synonyms: | 1-(1-Naphthalenyl)piperazine;1-(1-Naphthyl)piperazine;1-a-Naphthylpiperazine;N-(1-Naphthyl)piperazine; |
| CAS: | 57536-86-4 |
| Molecular Formula: | C14H16N2 |
| Molecular Weight: | 212.29024 |
| InChI: | InChI=1S/C14H16N2/c1-2-6-13-12(4-1)5-3-7-14(13)16-10-8-15-9-11-16/h1-7,15H,8-11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.106 g/cm3 |
| Refractive index: | 1.622 |
| Water Solubility: | Soluble in water (25 mg/ml); slightly soluble in ethanol. |
| Solubility: | Soluble in water (25 mg/ml); slightly soluble in ethanol. |
| Appearance: | White to tan powder |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Color: | white |
| Safety Data | |
 |
|
