| Identification | |
| Name: | 6-Methoxy-2-methyl-2H-1-benzopyran-3-carbonitrile |
| Synonyms: | 6-Methoxy-2-methyl-2H-1-benzopyran-3-carbonitrile |
| CAS: | 57543-75-6 |
| Molecular Formula: | C12H11NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H11NO2/c1-8-10(7-13)5-9-6-11(14-2)3-4-12(9)15-8/h3-6,8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.6°C |
| Boiling Point: | 344.8°C at 760 mmHg |
| Density: | 1.18g/cm3 |
| Refractive index: | 1.57 |
| Specification: |
6-Methoxy-2-methyl-2H-1-benzopyran-3-carbonitrile , its cas register number is57543-75-6. It also can be called 5-18-07-00380 (Beilstein Handbook Reference) ; BRN 1374809 . 6-Methoxy-2-methyl-2H-1-benzopyran-3-carbonitrile (CAS NO.57543-75-6) is moderate toxic by intraperitoneal route. When heated to decomposition it emits toxic vapors of NOx. |
| Flash Point: | 135.6°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
