| Identification | |
| Name: | Benzene,1-(bromomethyl)-4-methoxy-2-nitro- |
| Synonyms: | Anisole,4-(bromomethyl)-3-nitro- (6CI,7CI);2-Bromomethyl-5-methoxynitrobenzene;4-Methoxy-2-nitrobenzyl bromide;a-Bromo-4-methoxy-2-nitrotoluene; |
| CAS: | 57559-52-1 |
| Molecular Formula: | C8H8BrNO3 |
| Molecular Weight: | 246.05802 |
| InChI: | InChI=1/C8H8BrNO3/c1-13-7-3-2-6(5-9)8(4-7)10(11)12/h2-4H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.589 |
| Refractive index: | 1.588 |
| Specification: |
The 4-Methoxy-2-nitrobenzyl bromide is a kind of organic compounds with cas registry number of 57559-52-1. Both its systematic name and IUPAC name are the same which is called 1-(bromomethyl)-4-methoxy-2-nitrobenzene. The physical properties about this chemical are: (1)ACD/LogP: 2.87; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 3; (6)Index of Refraction: 1.588; (7)Molar Refractivity: 52.12 cm3; (8)Molar Volume: 154.7 cm3; (9)Surface Tension: 48.4 dyne/cm; (10)Density: 1.589 g/cm3; (11)Flash Point: 153.7 °C; (12)Enthalpy of Vaporization: 55.03 kJ/mol; (13)Boiling Point: 330.5 °C at 760 mmHg; (14)Vapour Pressure: 0.000319 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
