Identification |
Name: | 4-Morpholinecarboximidamide,N-cyclohexyl-N'-tricyclo[3.3.1.13,7]dec-1-yl-, hydrochloride (1:1) |
Synonyms: | 4-Morpholinecarboximidamide,N-cyclohexyl-N'-tricyclo[3.3.1.13,7]dec-1-yl-, monohydrochloride (9CI);N-[1-Adamantyl]-N-cyclohexyl-4-morpholinecarboxamidine hydrochloride; PNU37883A; U 37883A |
CAS: | 57568-80-6 |
Molecular Formula: | C21H35 N3 O . Cl H |
Molecular Weight: | 381.98 |
InChI: | InChI=1/C21H35N3O.ClH/c1-2-4-19(5-3-1)22-20(24-6-8-25-9-7-24)23-21-13-16-10-17(14-21)12-18(11-16)15-21;/h16-19H,1-15H2,(H,22,23);1H |
Molecular Structure: |
![(C21H35N3O.ClH) 4-Morpholinecarboximidamide,N-cyclohexyl-N'-tricyclo[3.3.1.13,7]dec-1-yl-, monohydrochloride (9CI);N...](https://img1.guidechem.com/chem/e/dict/1/57568-80-6.jpg) |
Properties |
Flash Point: | 240.5°C |
Boiling Point: | 474.1°Cat760mmHg |
Density: | g/cm3 |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Biological Activity: | Novel antagonist selective for the vascular form of K ATP channel; inhibits K ATP currents in isolated mesenteric artery smooth muscle cells (K d = 65 nM) but not in cardiac or skeletal myocytes. In vivo, inhibits blood vessel relaxation and hypotension induced by pinacidil. Displays weak diuretic effects. |
Flash Point: | 240.5°C |
Storage Temperature: | 2-8°C |
Color: | white |
Safety Data |
|
 |