| Identification | |
| Name: | 3-Methyl-6-methylaminouracil |
| Synonyms: | 3-methyl-6-(methylamino)pyrimidine-2,4(1H,3H)-dione;2,4(1H,3H)-pyrimidinedione, 3-methyl-6-(methylamino)-;3-Methyl-6-(methylamino)uracil;3-Methyl-6-(methylamino)pyrimidine-2,4(1H,3H)-dione; |
| CAS: | 5759-63-7 |
| Molecular Formula: | C6H9N3O2 |
| Molecular Weight: | 155.16 |
| InChI: | InChI=1/C6H9N3O2/c1-7-4-3-5(10)9(2)6(11)8-4/h3,7H,1-2H3,(H,8,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.3 g/cm3 |
| Refractive index: | 1.566 |
| Specification: |
The 3-Methyl-6-methylaminouracil with the cas number 5759-63-7, is also called 3-methyl-6-(methylamino)pyrimidine-2,4(1H,3H)-dione .The properties of the 3-Methyl-6-methylaminouracil are: (1)#H bond acceptors: 5 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 43.86 Å2 ; (5)Index of Refraction: 1.566 ; (6)Molar Refractivity: 38.87 cm3 ; (7)Molar Volume: 119 cm3 ; (8)Polarizability: 15.41×10-24cm3 ; (9)Surface Tension: 50.7 dyne/cm . This product can be supplied by the following suppliers: (1)BePharm,Ltd.; (2)Xinxiang Acemay Biochemicals Co., Ltd.; (3)Atomax Chemicals Co., Ltd.; (4)Shanghai PI Chemicals Ltd. ; (5)Suzhou Rovathin Foreign Trade Co.,Ltd.; (6)Link Chemicals Co.,Ltd.; (7)Hangzhou Sunny Chemical Co., Ltd.; (8)Shanghai FWD Chemicals Co., Ltd.; (9)BETAPHARMA (SHANGHAI) CO., LTD.. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
