| Identification | |
| Name: | 2-Quinolinemethanamine |
| Synonyms: | Quinoline,2-(aminomethyl)- (7CI,8CI);1-Quinolin-2-ylmethanamine;2-(Aminomethyl)quinoline;a-Aminoquinaldine; |
| CAS: | 5760-20-3 |
| Molecular Formula: | C10H10N2 |
| Molecular Weight: | 158.1998 |
| InChI: | InChI=1/C10H10N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7,11H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.6ºC |
| Boiling Point: | 292.3 ºC at 760 mmHg |
| Density: | 1.156 g/cm3 |
| Refractive index: | 1.662 |
| Specification: |
The 2-Quinolinemethanamine with the cas number 5760-20-3 is also called Quinoline,2-(aminomethyl)-. The IUPAC name is quinolin-2-ylmethanamine. Its molecular formula is C10H10N2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.96; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.72; (4)ACD/LogD (pH 7.4): -0.06; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 7.57; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 16.13Å2; (13)Index of Refraction: 1.662; (14)Molar Refractivity: 50.63 cm3; (15)Molar Volume: 136.7 cm3; (16)Polarizability: 20.07×10-24cm3; (17)Surface Tension: 54.2 dyne/cm; (18)Enthalpy of Vaporization: 53.18 kJ/mol; (19)Vapour Pressure: 0.00185 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 155.6ºC |
| Safety Data | |
 |
|
