| Identification |
| Name: | 3-Piperidinecarboxylicacid, 4-oxo-1-(phenylmethyl)-, methyl ester |
| Synonyms: | Nipecoticacid, 1-benzyl-4-oxo-, methyl ester (6CI);1-Benzyl-3-(methoxycarbonyl)-4-piperidone;1-Benzyl-4-oxopiperidine-3-carboxylic acid methyl ester;Methyl1-benzyl-4-oxo-3-piperidinecarboxylate;Methyl 1-benzyl-4-oxonipecotate;N-Benzyl-3-methoxycarbonyl-4-piperidone;N-Benzyl-4-oxonipecotic acid methylester; |
| CAS: | 57611-47-9 |
| Molecular Formula: | C14H17NO3 |
| Molecular Weight: | 247.29 |
| InChI: | InChI=1/C14H17NO3/c1-18-14(17)12-10-15(8-7-13(12)16)9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 175.2°C |
| Boiling Point: | 366°Cat760mmHg |
| Density: | 1.177g/cm3 |
| Refractive index: | 1.549 |
| Appearance: | Yellow solid |
| Flash Point: | 175.2°C |
| Usage: | Intermediate in the production of fentanyl analogs |
| Safety Data |
| |
 |
