| Identification | |
| Name: | Methanetriamine,N,N,N',N',N'',N''-hexamethyl- |
| Synonyms: | N,N,N',N',N'',N''-Hexamethylmethanetriamine;Tris(N,N-dimethylamino)methane; Tris(dimethylamino)methane |
| CAS: | 5762-56-1 |
| EINECS: | 227-284-0 |
| Molecular Formula: | C7H19 N3 |
| Molecular Weight: | 145.25 |
| InChI: | InChI=1/C7H19N3/c1-8(2)7(9(3)4)10(5)6/h7H,1-6H3/p+3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2733 3/PG 2 |
| Flash Point: | 28.2°C |
| Boiling Point: | 143.8°Cat760mmHg |
| Density: | 0.873g/cm3 |
| Refractive index: | n20/D 1.436(lit.) |
| Specification: | Clear colorless to slightly yellow liquid usageEng:Reagent for the introduction of the dimethylaminoethylidene group.1 General review;2 RO polymerization of lactide.3 Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 28.2°C |
| Storage Temperature: | 2-8°C |
| Usage: | Reagent for the introduction of the dimethylaminoethylidene group.1 General review;2 RO polymerization of lactide.3 |
| Safety Data | |
 |
|
