| Identification | |
| Name: | 1,1-Cyclopentanedimethanol |
| Synonyms: | 1,1-Bis(hydroxymethyl)cyclopentane;Cyclopentylidenedimethanol;NSC 49657; |
| CAS: | 5763-53-1 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.1849 |
| InChI: | InChI=1/C7H14O2/c8-5-7(6-9)3-1-2-4-7/h8-9H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.047 g/cm3 |
| Refractive index: | 1.481 |
| Specification: |
The 1,1-Cyclopentanedimethanol, with the CAS registry number 5763-53-1, is also known as 1,1-Bis(hydroxymethyl)cyclopentane. This chemical's molecular formula is C7H14O2 and molecular weight is 130.18. Its IUPAC name and systematic name are the same which is called [1-(hydroxymethyl)cyclopentyl]methanol. Physical properties of 1,1-Cyclopentanedimethanol: (1)ACD/LogP: 0.14 ; (2)#H bond acceptors: 2; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 4; (5)Polar Surface Area: 18.46 Å2; (6)Index of Refraction: 1.481; (7)Molar Refractivity: 35.42 cm3; (8)Molar Volume: 124.2 cm3; (9)Surface Tension: 47.7 dyne/cm; (10)Density: 1.047 g/cm3; (11)Flash Point: 124.4 °C; (12)Enthalpy of Vaporization: 57.53 kJ/mol; (13)Boiling Point: 257.7 °C at 760 mmHg; (14)Vapour Pressure: 0.00213 mmHg at 25°C. Preparation: this chemical can be prepared by cyclopentane-1,1-dicarboxylic acid diethyl ester. This reaction will need reagent LiAlH4. Uses of 1,1-Cyclopentanedimethanol: it can be used to produce 1,1-Bis-hydroxymethyl-cyclopentan-ditosylat. This reaction will need reagent pyridine. The yield is about 59%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
