Identification |
Name: | Benzamide,N-[2-(diethylamino)ethyl]-4-[(1-oxo-2-propen-1-yl)amino]- |
Synonyms: | Benzamide,N-[2-(diethylamino)ethyl]-4-[(1-oxo-2-propenyl)amino]- (9CI); Acrylylprocaine amide |
CAS: | 57631-93-3 |
Molecular Formula: | C16H23 N3 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C16H23N3O2/c1-4-15(20)18-14-9-7-13(8-10-14)16(21)17-11-12-19(5-2)6-3/h4,7-10H,1,5-6,11-12H2,2-3H3,(H,17,21)(H,18,20) |
Molecular Structure: |
|
Properties |
Flash Point: | 258.9°C |
Boiling Point: | 504.4°Cat760mmHg |
Density: | 1.095g/cm3 |
Specification: |
Procainamide acryloyl monomer , its cas register number is57631-93-3. It also can be called Acryloyl procainamide monomer ; Acrylylprocaine amid ; Benzamide, N-(2-(diethylamino)ethyl)-4-((1-oxo-2-propenyl)amino)- . When heated to decomposition it emits acrid smoke and irritating vapors. Wear suitable protective clothing and gloves when contact with Procainamide acryloyl monomer (CAS NO.57631-93-3).
|
Flash Point: | 258.9°C |
Safety Data |
|
|