| Identification | |
| Name: | GAMMA-ACETYLENIC GABA |
| Synonyms: | 4-AMINO-5-HEXYNOIC ACID;GAMMA-ACETYLENIC GABA;4-amino-5-hexynoicaci;RMI-71645 |
| CAS: | 57659-38-8 |
| Molecular Formula: | C6H9NO2 |
| Molecular Weight: | 127.14 |
| InChI: | InChI=1/C6H9NO2/c1-2-5(7)3-4-6(8)9/h1,5H,3-4,7H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.8°C |
| Boiling Point: | 291.1°C at 760 mmHg |
| Density: | 1.155g/cm3 |
| Refractive index: | 1.506 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 129.8°C |
| Color: | white |
| Safety Data | |
 |
|
