Identification |
Name: | 2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,3-butadiene and 2-propenenitrile |
Synonyms: | 2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,3-butadiene and 2-propenenitrile |
CAS: | 57693-55-7 |
Molecular Formula: | C12H17NO3 |
Molecular Weight: | 223.26828 |
InChI: | InChI=1S/C5H8O3.C4H6.C3H3N/c1-2-5(7)8-4-3-6;1-3-4-2;1-2-3-4/h2,6H,1,3-4H2;3-4H,1-2H2;2H,1H2 |
Molecular Structure: |
![(C12H17NO3) 2-Propenoic acid, 2-hydroxyethyl ester, polymer with 1,3-butadiene and 2-propenenitrile](https://img.guidechem.com/crawlimg/57693-55-7.png) |
Properties |
Flash Point: | 98.3°C |
Boiling Point: | 196.2°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 98.3°C |
Safety Data |
|
![](/images/detail_15.png) |