| Identification | |
| Name: | ETHYLTETRAMETHYLCYCLOPENTADIENE |
| Synonyms: | ETHYLTETRAMETHYLCYCLOPENTADIENE;ETHYLTETRAMETHYLCYCLOPENTADIENE, 97%, MI XTURE OF ISOMERS;Ethyltetramethylcyclopentadiene,mixture of isom. Tech.;ETHYLTETRAMETHYLCYCLOPENTADIENE, 90%, TECH., MIXTURE OF ISOMERS;Ethyltetramethylcyclopentadiene, tech., mixture of isomers |
| CAS: | 57693-77-3 |
| Molecular Formula: | C11H18 |
| Molecular Weight: | 150.26 |
| InChI: | InChI=1/C11H18/c1-6-11-9(4)7(2)8(3)10(11)5/h11H,6H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 3 |
| Flash Point: | 132 °F |
| Boiling Point: | 6062°C5mm Hg |
| Density: | 0.841g/mL25°C |
| Refractive index: | n20/D 1.479 |
| Packinggroup: | III |
| Flash Point: | 132 °F |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
