| Identification | |
| Name: | 1H-Purine-2,6-dione,8-ethoxy-3,7-dihydro-1,3,7-trimethyl- |
| Synonyms: | Caffeine,8-ethoxy- (6CI,7CI,8CI); 1,3,7-Trimethyl-2,6-dioxo-8-ethoxypurine;8-Ethoxycaffeine; EOC; NSC 8812 |
| CAS: | 577-66-2 |
| Molecular Formula: | C10H14 N4 O3 |
| Molecular Weight: | 238.28 |
| InChI: | InChI=1/C10H14N4O3/c1-5-17-9-11-7-6(12(9)2)8(15)14(4)10(16)13(7)3/h5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.2°C |
| Boiling Point: | 402.5°Cat760mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.628 |
| Specification: |
8-Ethoxycaffeine (CAS NO.577-66-2) also can be called 1H-Purine-2,6-dione, 8-ethoxy-3,7-dihydro-1,3,7-trimethyl- (9CI) ; and 8-Ethoxy-3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 197.2°C |
| Safety Data | |
 |
|
