Identification |
Name: | Benzenepropanamine, g-(2-methoxyphenoxy)-N-methyl-,hydrochloride (1:1) |
CAS: | 57754-86-6 |
Molecular Formula: | C17H22ClNO2 |
Molecular Weight: | 307.82 |
InChI: | InChI=1/C17H21NO2.ClH/c1-18-13-12-15(14-8-4-3-5-9-14)20-17-11-7-6-10-16(17)19-2;/h3-11,15,18H,12-13H2,1-2H3;1H |
Molecular Structure: |
|
Properties |
Flash Point: | 170.6°C |
Boiling Point: | 404.8°Cat760mmHg |
Density: | 1.054g/cm3 |
Solubility: | H2O: 20 mg/mL |
Appearance: | white solid |
Biological Activity: | A potent and selective inhibitor of noradrenalin uptake with little or no affinity for a range of other neurotransmitter receptors. |
Flash Point: | 170.6°C |
Storage Temperature: | 2-8°C |
Color: | white |
Safety Data |
|
|