Identification |
Name: | Benzamide,N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodo- |
Synonyms: | NSC 335306;Zycloz; |
CAS: | 57808-65-8 |
EINECS: | 260-967-1 |
Molecular Formula: | C22H14Cl2I2N2O2 |
Molecular Weight: | 663.0737 |
InChI: | InChI=1S/C22H14Cl2I2N2O2/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29/h2-9,17,29H,1H3,(H,28,30) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Melting Point: | 210 - 220C |
Flash Point: | 310.9°C |
Boiling Point: | 590.5°Cat760mmHg |
Density: | 1.943g/cm3 |
Refractive index: | 1.736 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | white to yellowish powder |
Packinggroup: | III |
Flash Point: | 310.9°C |
Storage Temperature: | 0-6°C |
Usage: | Used to control fasciolosis in animals. . |
Safety Data |
|
 |