| Identification | |
| Name: | Metalaxyl |
| Synonyms: | N-(2,6-Dimethylphenyl)-N-(methoxy acetyl)-alanine methyl ester; methyl N-(methoxyacetyl)-N-(2,6-xylyl)-DL-alaninate |
| CAS: | 57837-19-1 |
| EINECS: | 260-979-7 |
| Molecular Formula: | C15H21NO4 |
| Molecular Weight: | 279.33 |
| InChI: | InChI=1/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1648 |
| Density: | 1.117 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.527 |
| Water Solubility: | 0.84 g/100 mL |
| Solubility: | 0.84 g/100 mL in water |
| Specification: |
??Metalaxyl ,? its cas register number is 57837-19-1. It also can be called?Allegiance ; Apron ; Apron SD 35 ; Caswell No. 375AA ; D,L-N-(2,6-Dimethylphenyl)-N-(2'-methoxyacetyl)alaninate de methyle ; Metalaxil ; Metanaxin ; Methyl N-(2-methoxyacetyl)-N-(2,6-xylyl)-DL-alaninate ; N-(2,6-Dimethylphenyl)-N-(methoxyacetyl)-alanine methyl ester ; Ridomil ; |
| Color: | Fine, white powder ... Colorless crystals ... . |
| Usage: | Agricultural fungicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
