| Identification | |
| Name: | 4-Bromo-2-fluorobenzaldehyde |
| Synonyms: | 4-bromo-2-fluoro-benzaldehyde;2-fluoro-4-bromobenzaldehyde;2-bromo-4-fluorobenzaldehyde; |
| CAS: | 57848-46-1 |
| EINECS: | 298-056-6 |
| Molecular Formula: | C7H4BrFO |
| Molecular Weight: | 203.008463 |
| InChI: | InChI=1S/C7H4BrFO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.67 g/cm3 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | light yellow to beige crystalline solid, crystals |
| Specification: |
?4-Bromo-2-Fluorobenzaldehyde ,?its cas register number is 57848-46-1. It also can be called?Benzaldehyde, 4-bromo-2-fluoro-?;?2-Fluoro-4-bromobenzaldehyde ;?4-Bromo-2-Fluorobenzaldehyde2-Fluoro-4-Bromobenzaldehyde?. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
