| Identification | |
| Name: | Methyl-(1-methylhexyl)ammonium chloride |
| Synonyms: | 2-heptanamine, N-methyl-, hydrochloride (1:1);N-Methylheptan-2-amine hydrochloride (1:1) |
| CAS: | 5787-73-5 |
| Molecular Formula: | C8H19N . ClH |
| Molecular Weight: | 165.7041 |
| InChI: | InChI=1/C8H19N.ClH/c1-4-5-6-7-8(2)9-3;/h8-9H,4-7H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 30.5°C |
| Boiling Point: | 151.7°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Methyl-(1-methylhexyl)ammonium chloride with CAS number of 5787-73-5 is also named as 2-Methylamino-heptane, hydrochloride ; EA-1 hydrochloride ; N,1-Dimethylhexylamine hydrochloride ; Neosupranol hydrochloride ; Oenethyl hydrochloride ; Pacamine hydrochloride . |
| Flash Point: | 30.5°C |
| Safety Data | |
 |
|
