| Identification | |
| Name: | Imidazo[1,2-a]pyridine,2-(chloromethyl)- |
| Synonyms: | 2-(Chloromethyl)imidazo[1,2-a]pyridine;imidazo[1,2-a]pyridine, 2-(chloromethyl)-; |
| CAS: | 57892-76-9 |
| Molecular Formula: | C8H7ClN2 |
| Molecular Weight: | 166.6076 |
| InChI: | InChI=1S/C8H7ClN2/c9-5-7-6-11-4-2-1-3-8(11)10-7/h1-4,6H,5H2 |
| Molecular Structure: | ![(C8H7ClN2) 2-(Chloromethyl)imidazo[1,2-a]pyridine;imidazo[1,2-a]pyridine, 2-(chloromethyl)-;](https://img1.guidechem.com/chem/e/dict/137/57892-76-9.jpg) |
| Properties | |
| Density: | 1.29 g/cm3 |
| Specification: |
The 2-Chloromethylimidazo[1,2-a]pyridine hydrochloride, with the cas registry number 57892-76-9, has the systematic name and IUPAC name of 2-(chloromethyl)imidazo[1,2-a]pyridine. It belongs to the category of Halometyl. And it is a kind of irritant chemical, so you'd bettter be cautious while dealing with it. The molecular formula of the chemical is C8H7ClN2. The characteristics of this chemical are as followings: (1)XLogP3-AA 2.2; (2)H-Bond Donor 0; (3)H-Bond Acceptor 1; (4)Rotatable Bond Count 1; (5)Exact Mass 166.029776; (6)MonoIsotopic Mass 166.029776; (7)Topological Polar Surface Area 17.3; (8)Heavy Atom Count 11; (9)Formal Charge 0; (10)Complexity 140; (11)Isotope Atom Count 0; (12)Defined Atom StereoCenter Count 0; (13)Undefined Atom StereoCenter Count 0; (14)Defined Bond StereoCenter Count 0; (15)Undefined Bond StereoCenter Count 0; (16)Covalently-Bonded Unit Count 1. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
