Identification |
Name: | 1,2-Propanedione,1-phenyl- |
Synonyms: | 1-Phenyl-2-oxopropan-1-one;2-Oxopropiophenone;3-Phenyl-2,3-propanedione;Acetylbenzoyl;Benzoyl methyl ketone;Benzoylacetyl;Methylphenylglyoxal;NSC7643;Pyruvophenone; |
CAS: | 579-07-7 |
EINECS: | 209-435-2 |
Molecular Formula: | C9H8O2 |
Molecular Weight: | 148.16 |
InChI: | InChI=1/C9H8O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-6H,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | <20 |
Density: | 1.101 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.53-1.534 |
Solubility: | Slightly soluble |
Appearance: | Clear yellow liquid. |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |