| Identification |
| Name: | 1,2-Propanedione,1-phenyl- |
| Synonyms: | 1-Phenyl-2-oxopropan-1-one;2-Oxopropiophenone;3-Phenyl-2,3-propanedione;Acetylbenzoyl;Benzoyl methyl ketone;Benzoylacetyl;Methylphenylglyoxal;NSC7643;Pyruvophenone; |
| CAS: | 579-07-7 |
| EINECS: | 209-435-2 |
| Molecular Formula: | C9H8O2 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C9H8O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-6H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | <20 |
| Density: | 1.101 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.53-1.534 |
| Solubility: | Slightly soluble |
| Appearance: | Clear yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
