| Identification |
| Name: | Ethanone,1-(2-methoxyphenyl)- |
| Synonyms: | Acetophenone,2'-methoxy- (8CI);Acetophenone, o-methoxy- (4CI);1-(2-Methoxyphenyl)ethanone;2-Acetylanisole;2-Methoxyphenyl methyl ketone;2'-Methoxyacetophenone;Methyl2-methoxyphenyl ketone;Methyl o-methoxyphenyl ketone;NSC 23387;NSC 26912;o-Acetylanisole;o-Methoxyacetophenone; |
| CAS: | 579-74-8 |
| EINECS: | 209-446-2 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to light. |
| Refractive index: | 1.5383-1.5403 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Clear, colorless liquid. |
| HS Code: | 29145000 |
| Storage Temperature: | Do not store in direct sunlight. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
