| Identification | |
| Name: | Peroxide, nitro1-oxopropyl |
| Synonyms: | Peroxypropionylnitrate (7CI,8CI); Nitric acid anhydride with peroxypropionic acid; Nitricacid, anhydride with propaneperoxoic acid; PPN; PPN (oxidant); Peroxypropionicacid anhydride with nitric acid; Propaneperoxoic acid anhydride with nitricacid |
| CAS: | 5796-89-4 |
| Molecular Formula: | C3H5 N O5 |
| Molecular Weight: | 135.08 |
| InChI: | InChI=1/C3H5NO5/c1-2-3(5)8-9-4(6)7/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 86.5°C |
| Boiling Point: | 174.4°Cat760mmHg |
| Density: | 1.341g/cm3 |
| Refractive index: | 1.42 |
| Specification: |
Peroxypropionyl nitrate , its cas register number is 5796-89-4. It also can be called POPN ; and Peroxide, nitro 1-oxopropyl . |
| Flash Point: | 86.5°C |
| Safety Data | |
 |
|
